C27H31NO — CID 138601952
(3E,4E)-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 138601952) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is (3E,4E)-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,4E)-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138601952 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (3E,4E)-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-5-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C1/C(=O)NC(C(=C)/C=C\C(C)=C/C)(/C(C=C)=C/C=C(/C)C=C)/C1=C/C=C |
| InChI | InChI=1S/C27H31NO/c1-9-14-24-25(15-10-2)27(28-26(24)29,22(8)18-16-20(6)11-3)23(13-5)19-17-21(7)12-4/h9-19H,1-2,4-5,8H2,3,6-7H3,(H,28,29)/b18-16-,20-11-,21-17-,23-19+,24-14+,25-15+ |
| InChIKey | QDFFJMJCSUZVOL-ARTMWNKGSA-N |
| XLogP | 6.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|