C24H27NO3 — CID 138602016
(3E,4E)-5-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]-5-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 138602016) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (3E,4E)-5-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]-5-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,4E)-5-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]-5-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138602016 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3E,4E)-5-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]-5-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C1/C(=O)NC(C(=C)/C=C\C(O)=C/C)(/C(C)=C/C=C(/O)C=C)/C1=C/C=C |
| InChI | InChI=1S/C24H27NO3/c1-7-11-21-22(12-8-2)24(25-23(21)28,17(5)13-15-19(26)9-3)18(6)14-16-20(27)10-4/h7-16,26-27H,1-3,6H2,4-5H3,(H,25,28)/b16-14-,17-13+,19-15+,20-10+,21-11+,22-12+ |
| InChIKey | HGRIVADMKOOKHI-YQHNWAGCSA-N |
| XLogP | 5.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|