C18H22N2O — CID 138602838
(2E,5E)-4-N-ethenyl-2-(2-methoxypropylidene)-1-N-methyl-3,6-dimethylidene-5-prop-2-enylidenecyclohexane-1,4-diimine (PubChem CID 138602838) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (2E,5E)-4-N-ethenyl-2-(2-methoxypropylidene)-1-N-methyl-3,6-dimethylidene-5-prop-2-enylidenecyclohexane-1,4-diimine.
| Compound Name | (2E,5E)-4-N-ethenyl-2-(2-methoxypropylidene)-1-N-methyl-3,6-dimethylidene-5-prop-2-enylidenecyclohexane-1,4-diimine |
|---|---|
| PubChem CID | 138602838 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2E,5E)-4-N-ethenyl-2-(2-methoxypropylidene)-1-N-methyl-3,6-dimethylidene-5-prop-2-enylidenecyclohexane-1,4-diimine |
| SMILES | C=C/C=C1\C(=C)C(=N\C)/C(=C/C(C)OC)C(=C)\C1=N\C=C |
| InChI | InChI=1S/C18H22N2O/c1-8-10-15-13(4)17(19-6)16(11-12(3)21-7)14(5)18(15)20-9-2/h8-12H,1-2,4-5H2,3,6-7H3/b15-10+,16-11+,19-17+,20-18+ |
| InChIKey | XAVCGRVQENJWTI-WVFXJVLVSA-N |
| XLogP | 3.84 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|