About N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide
N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide (PubChem CID 138602873) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide.
Molecular Properties
| Compound Name | N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide |
| PubChem CID | 138602873 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide |
| SMILES | C=C(CC(C)(C)NC(=O)C(=O)N(C)C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-10(11(19)16-14(2,3)4)9-15(5,6)17-12(20)13(21)18(7)8/h1,9H2,2-8H3,(H,16,19)(H,17,20) |
| InChIKey | JGKVMBYBHGQLFX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide?
The IUPAC name of N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide (CID 138602873) is N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide.
What is the SMILES notation for N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide?
The canonical SMILES for N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide is C=C(CC(C)(C)NC(=O)C(=O)N(C)C)C(=O)NC(C)(C)C.
What is the InChIKey of N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide?
The InChIKey is JGKVMBYBHGQLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O3/c1-10(11(19)16-14(2,3)4)9-15(5,6)17-12(20)13(21)18(7)8/h1,9H2,2-8H3,(H,16,19)(H,17,20).
What are the key properties of N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide?
N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide has a molecular weight of 297.40 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(tert-butylcarbamoyl)-2-methylpent-4-en-2-yl]-N',N'-dimethyloxamide is sourced from PubChem (CID 138602873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).