About 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide
1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide (PubChem CID 138603770) has the molecular formula C11H19F3N2O
and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide |
| PubChem CID | 138603770 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide |
| SMILES | CCN1CCC(C(=O)NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-2-16-7-3-9(4-8-16)10(17)15-6-5-11(12,13)14/h9H,2-8H2,1H3,(H,15,17) |
| InChIKey | QGIUAATWSCCGET-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide?
The IUPAC name of 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide (CID 138603770) is 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide.
What is the SMILES notation for 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide?
The canonical SMILES for 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide is CCN1CCC(C(=O)NCCC(F)(F)F)CC1.
What is the InChIKey of 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide?
The InChIKey is QGIUAATWSCCGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O/c1-2-16-7-3-9(4-8-16)10(17)15-6-5-11(12,13)14/h9H,2-8H2,1H3,(H,15,17).
What are the key properties of 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide?
1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide has a molecular weight of 252.28 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(3,3,3-trifluoropropyl)piperidine-4-carboxamide is sourced from PubChem (CID 138603770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).