C4H2F9NO — CID 138604570
O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]hydroxylamine (PubChem CID 138604570) has the molecular formula C4H2F9NO and a molecular weight of 251.05 g/mol. Its IUPAC name is O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]hydroxylamine.
| Compound Name | O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 138604570 |
| Molecular Formula | C4H2F9NO |
| Molecular Weight | 251.05 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]hydroxylamine |
| SMILES | NOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F9NO/c5-2(6,7)1(15-14,3(8,9)10)4(11,12)13/h14H2 |
| InChIKey | PDRWSXSRHOGFSP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.05 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|