About 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide
5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide (PubChem CID 138605207) has the molecular formula C15H29NO2S
and a molecular weight of 287.47 g/mol. Its IUPAC name is 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide.
Molecular Properties
| Compound Name | 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide |
| PubChem CID | 138605207 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide |
| SMILES | CC(C)(C)CC1CCC2(CS(=O)(=O)C2)N1C(C)(C)C |
| InChI | InChI=1S/C15H29NO2S/c1-13(2,3)9-12-7-8-15(10-19(17,18)11-15)16(12)14(4,5)6/h12H,7-11H2,1-6H3 |
| InChIKey | WLQUHXLXJSBGTM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide?
The IUPAC name of 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide (CID 138605207) is 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide.
What is the SMILES notation for 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide?
The canonical SMILES for 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide is CC(C)(C)CC1CCC2(CS(=O)(=O)C2)N1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide?
The InChIKey is WLQUHXLXJSBGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2S/c1-13(2,3)9-12-7-8-15(10-19(17,18)11-15)16(12)14(4,5)6/h12H,7-11H2,1-6H3.
What are the key properties of 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide?
5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide has a molecular weight of 287.47 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-6-(2,2-dimethylpropyl)-2λ6-thia-5-azaspiro[3.4]octane 2,2-dioxide is sourced from PubChem (CID 138605207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).