C15H16F3N3O2S — CID 138605439
(5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-(3,3-difluorocyclobutyl)sulfonyl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605439) has the molecular formula C15H16F3N3O2S and a molecular weight of 359.37 g/mol. Its IUPAC name is (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-(3,3-difluorocyclobutyl)sulfonyl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-(3,3-difluorocyclobutyl)sulfonyl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605439 |
| Molecular Formula | C15H16F3N3O2S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-(3,3-difluorocyclobutyl)sulfonyl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | O=S(=O)(c1nc2n(n1)[C@H](C1C=CC=CC1)C[C@@H]2F)C1CC(F)(F)C1 |
| InChI | InChI=1S/C15H16F3N3O2S/c16-11-6-12(9-4-2-1-3-5-9)21-13(11)19-14(20-21)24(22,23)10-7-15(17,18)8-10/h1-4,9-12H,5-8H2/t9?,11-,12-/m0/s1 |
| InChIKey | SVNFMRFCXWNKNL-WEBCLNCGSA-N |
| XLogP | 2.94 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |