C16H18F3N3O2S — CID 138605449
(5S,7S)-2-[1-(difluoromethyl)cyclopropyl]sulfonyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605449) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is (5S,7S)-2-[1-(difluoromethyl)cyclopropyl]sulfonyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-[1-(difluoromethyl)cyclopropyl]sulfonyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605449 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (5S,7S)-2-[1-(difluoromethyl)cyclopropyl]sulfonyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | CC1([C@@H]2C[C@H](F)c3nc(S(=O)(=O)C4(C(F)F)CC4)nn32)C=CC=CC1 |
| InChI | InChI=1S/C16H18F3N3O2S/c1-15(5-3-2-4-6-15)11-9-10(17)12-20-14(21-22(11)12)25(23,24)16(7-8-16)13(18)19/h2-5,10-11,13H,6-9H2,1H3/t10-,11-,15?/m0/s1 |
| InChIKey | HYZWFPGOUDXDRP-AKABHXMESA-N |
| XLogP | 3.33 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |