C15H16F3N3OS — CID 138605455
(5S,7S)-2-(2,2-difluorocyclopropyl)sulfinyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605455) has the molecular formula C15H16F3N3OS and a molecular weight of 343.37 g/mol. Its IUPAC name is (5S,7S)-2-(2,2-difluorocyclopropyl)sulfinyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-(2,2-difluorocyclopropyl)sulfinyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605455 |
| Molecular Formula | C15H16F3N3OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (5S,7S)-2-(2,2-difluorocyclopropyl)sulfinyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | CC1([C@@H]2C[C@H](F)c3nc(S(=O)C4CC4(F)F)nn32)C=CC=CC1 |
| InChI | InChI=1S/C15H16F3N3OS/c1-14(5-3-2-4-6-14)10-7-9(16)12-19-13(20-21(10)12)23(22)11-8-15(11,17)18/h2-5,9-11H,6-8H2,1H3/t9-,10-,11?,14?,23?/m0/s1 |
| InChIKey | VPTSHJFMNLORNK-AXFTYJQTSA-N |
| XLogP | 3.27 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |