C12H10ClF4N3O2S — CID 138605469
(5S,7S)-5-(3-chloro-6-fluorocyclohexa-2,4-dien-1-yl)-2-(difluoromethylsulfonyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605469) has the molecular formula C12H10ClF4N3O2S and a molecular weight of 371.74 g/mol. Its IUPAC name is (5S,7S)-5-(3-chloro-6-fluorocyclohexa-2,4-dien-1-yl)-2-(difluoromethylsulfonyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-5-(3-chloro-6-fluorocyclohexa-2,4-dien-1-yl)-2-(difluoromethylsulfonyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605469 |
| Molecular Formula | C12H10ClF4N3O2S |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (5S,7S)-5-(3-chloro-6-fluorocyclohexa-2,4-dien-1-yl)-2-(difluoromethylsulfonyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | O=S(=O)(c1nc2n(n1)[C@H](C1C=C(Cl)C=CC1F)C[C@@H]2F)C(F)F |
| InChI | InChI=1S/C12H10ClF4N3O2S/c13-5-1-2-7(14)6(3-5)9-4-8(15)10-18-12(19-20(9)10)23(21,22)11(16)17/h1-3,6-9,11H,4H2/t6?,7?,8-,9-/m0/s1 |
| InChIKey | PAHJGLYDEQTQEY-PEBLOWIWSA-N |
| XLogP | 2.88 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |