C15H18F3N3O3S — CID 138605486
(5S,7S)-2-[2-(difluoromethoxy)ethylsulfonyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605486) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is (5S,7S)-2-[2-(difluoromethoxy)ethylsulfonyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-[2-(difluoromethoxy)ethylsulfonyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605486 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (5S,7S)-2-[2-(difluoromethoxy)ethylsulfonyl]-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C[C@H](F)c2nc(S(=O)(=O)CCOC(F)F)nn21 |
| InChI | InChI=1S/C15H18F3N3O3S/c1-3-4-5-6-10(2)12-9-11(16)13-19-15(20-21(12)13)25(22,23)8-7-24-14(17)18/h3-6,11-12,14H,2,7-9H2,1H3/b4-3-,6-5-/t11-,12-/m0/s1 |
| InChIKey | IRWFQKMSFCETFR-PQAUAXEHSA-N |
| XLogP | 2.93 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|