C15H18FN3O2S — CID 138605495
(5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(1S,2S)-2-methylcyclopropyl]sulfonyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605495) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is (5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(1S,2S)-2-methylcyclopropyl]sulfonyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(1S,2S)-2-methylcyclopropyl]sulfonyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605495 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-2-[(1S,2S)-2-methylcyclopropyl]sulfonyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C[C@H]1C[C@@H]1S(=O)(=O)c1nc2n(n1)[C@H](C1C=CC=CC1)C[C@@H]2F |
| InChI | InChI=1S/C15H18FN3O2S/c1-9-7-13(9)22(20,21)15-17-14-11(16)8-12(19(14)18-15)10-5-3-2-4-6-10/h2-5,9-13H,6-8H2,1H3/t9-,10?,11-,12-,13-/m0/s1 |
| InChIKey | KXHNEHQRIGIHJI-GVPCSFRDSA-N |
| XLogP | 2.55 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |