C14H17F2N3S — CID 138605528
(5S,7S)-7-fluoro-2-(1-fluoroethylsulfanyl)-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605528) has the molecular formula C14H17F2N3S and a molecular weight of 297.37 g/mol. Its IUPAC name is (5S,7S)-7-fluoro-2-(1-fluoroethylsulfanyl)-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-7-fluoro-2-(1-fluoroethylsulfanyl)-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605528 |
| Molecular Formula | C14H17F2N3S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (5S,7S)-7-fluoro-2-(1-fluoroethylsulfanyl)-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | CC(F)Sc1nc2n(n1)[C@H](C1(C)C=CC=CC1)C[C@@H]2F |
| InChI | InChI=1S/C14H17F2N3S/c1-9(15)20-13-17-12-10(16)8-11(19(12)18-13)14(2)6-4-3-5-7-14/h3-6,9-11H,7-8H2,1-2H3/t9?,10-,11-,14?/m0/s1 |
| InChIKey | GSFKFLZERTYMSN-JXJNQWLDSA-N |
| XLogP | 4.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |