C14H16FN3OS — CID 138605532
(5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-[(R)-cyclopropylsulfinyl]-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138605532) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-[(R)-cyclopropylsulfinyl]-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-[(R)-cyclopropylsulfinyl]-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138605532 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (5S,7S)-5-cyclohexa-2,4-dien-1-yl-2-[(R)-cyclopropylsulfinyl]-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | O=[S@@](c1nc2n(n1)[C@H](C1C=CC=CC1)C[C@@H]2F)C1CC1 |
| InChI | InChI=1S/C14H16FN3OS/c15-11-8-12(9-4-2-1-3-5-9)18-13(11)16-14(17-18)20(19)10-6-7-10/h1-4,9-12H,5-8H2/t9?,11-,12-,20+/m0/s1 |
| InChIKey | ILMPLNCTXDGMAD-MAOYTVRJSA-N |
| XLogP | 2.64 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |