About [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid
[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid (PubChem CID 138606231) has the molecular formula C13H18N3O8P
and a molecular weight of 375.27 g/mol. Its IUPAC name is [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid.
Molecular Properties
| Compound Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid |
| PubChem CID | 138606231 |
| Molecular Formula | C13H18N3O8P |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid |
| SMILES | O=C(CCN(CCN1CC=CC1=O)P(=O)(O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H18N3O8P/c17-10-2-1-6-14(10)8-9-15(25(21,22)23)7-5-13(20)24-16-11(18)3-4-12(16)19/h1-2H,3-9H2,(H2,21,22,23) |
| InChIKey | NBKJKLYLVIVTIL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid?
The IUPAC name of [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid (CID 138606231) is [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid.
What is the SMILES notation for [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid?
The canonical SMILES for [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid is O=C(CCN(CCN1CC=CC1=O)P(=O)(O)O)ON1C(=O)CCC1=O.
What is the InChIKey of [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid?
The InChIKey is NBKJKLYLVIVTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N3O8P/c17-10-2-1-6-14(10)8-9-15(25(21,22)23)7-5-13(20)24-16-11(18)3-4-12(16)19/h1-2H,3-9H2,(H2,21,22,23).
What are the key properties of [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid?
[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid has a molecular weight of 375.27 g/mol, XLogP of -1.22, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphonic acid is sourced from PubChem (CID 138606231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).