4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid

C10H14N2O3 — CID 138606615

IUPAC4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid
SMILESCc1cnc(C2CCN(C(=O)O)CC2)o1
InChIInChI=1S/C10H14N2O3/c1-7-6-11-9(15-7)8-2-4-12(5-3-8)10(13)14/h6,8H,2-5H2,1H3,(H,13,14)
InChIKeyGWTHIMDDQYWHLX-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.84
Rot. Bonds1

About 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid

4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid (PubChem CID 138606615) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid
PubChem CID138606615
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid
SMILESCc1cnc(C2CCN(C(=O)O)CC2)o1
InChIInChI=1S/C10H14N2O3/c1-7-6-11-9(15-7)8-2-4-12(5-3-8)10(13)14/h6,8H,2-5H2,1H3,(H,13,14)
InChIKeyGWTHIMDDQYWHLX-UHFFFAOYSA-N
XLogP1.84
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid?
The IUPAC name of 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid (CID 138606615) is 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid?
The canonical SMILES for 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid is Cc1cnc(C2CCN(C(=O)O)CC2)o1.
What is the InChIKey of 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid?
The InChIKey is GWTHIMDDQYWHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-7-6-11-9(15-7)8-2-4-12(5-3-8)10(13)14/h6,8H,2-5H2,1H3,(H,13,14).
What are the key properties of 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid?
4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid has a molecular weight of 210.23 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,3-oxazol-2-yl)piperidine-1-carboxylic acid is sourced from PubChem (CID 138606615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).