C15H16O2 — CID 138606682
(2R,11R)-tricyclo[9.4.0.02,7]pentadeca-4,8,13-triene-3,15-dione (PubChem CID 138606682) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (2R,11R)-tricyclo[9.4.0.02,7]pentadeca-4,8,13-triene-3,15-dione.
| Compound Name | (2R,11R)-tricyclo[9.4.0.02,7]pentadeca-4,8,13-triene-3,15-dione |
|---|---|
| PubChem CID | 138606682 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2R,11R)-tricyclo[9.4.0.02,7]pentadeca-4,8,13-triene-3,15-dione |
| SMILES | O=C1C=CC[C@H]2CC=CC3CC=CC(=O)[C@H]3C12 |
| InChI | InChI=1S/C15H16O2/c16-12-8-2-6-10-4-1-5-11-7-3-9-13(17)15(11)14(10)12/h1-4,8-11,14-15H,5-7H2/t10?,11-,14+,15?/m1/s1 |
| InChIKey | TWHHUCVICSSUMP-ZISVTKSWSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|