C19H24O4 — CID 138606706
(1R,4aS,4bS,8aR,10aS)-1-(dimethoxymethyl)-3,10-dimethyl-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione (PubChem CID 138606706) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1R,4aS,4bS,8aR,10aS)-1-(dimethoxymethyl)-3,10-dimethyl-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione.
| Compound Name | (1R,4aS,4bS,8aR,10aS)-1-(dimethoxymethyl)-3,10-dimethyl-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione |
|---|---|
| PubChem CID | 138606706 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1R,4aS,4bS,8aR,10aS)-1-(dimethoxymethyl)-3,10-dimethyl-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione |
| SMILES | COC(OC)[C@@H]1C=C(C)C(=O)[C@@H]2[C@H]3C(=O)C=CC[C@@H]3C=C(C)[C@H]21 |
| InChI | InChI=1S/C19H24O4/c1-10-8-12-6-5-7-14(20)16(12)17-15(10)13(19(22-3)23-4)9-11(2)18(17)21/h5,7-9,12-13,15-17,19H,6H2,1-4H3/t12-,13-,15+,16-,17+/m1/s1 |
| InChIKey | NRWJRSQODYZSRF-GJVDQKBNSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|