C20H28O4 — CID 138606711
(4S,5R,6S)-4-(dimethoxymethyl)-2,6-dimethyl-5-[(Z)-1-[(1R)-5-oxocyclohex-3-en-1-yl]prop-1-en-2-yl]cyclohex-2-en-1-one (PubChem CID 138606711) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4S,5R,6S)-4-(dimethoxymethyl)-2,6-dimethyl-5-[(Z)-1-[(1R)-5-oxocyclohex-3-en-1-yl]prop-1-en-2-yl]cyclohex-2-en-1-one.
| Compound Name | (4S,5R,6S)-4-(dimethoxymethyl)-2,6-dimethyl-5-[(Z)-1-[(1R)-5-oxocyclohex-3-en-1-yl]prop-1-en-2-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 138606711 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4S,5R,6S)-4-(dimethoxymethyl)-2,6-dimethyl-5-[(Z)-1-[(1R)-5-oxocyclohex-3-en-1-yl]prop-1-en-2-yl]cyclohex-2-en-1-one |
| SMILES | COC(OC)[C@H]1C=C(C)C(=O)[C@@H](C)[C@@H]1/C(C)=C\[C@@H]1CC=CC(=O)C1 |
| InChI | InChI=1S/C20H28O4/c1-12(9-15-7-6-8-16(21)11-15)18-14(3)19(22)13(2)10-17(18)20(23-4)24-5/h6,8-10,14-15,17-18,20H,7,11H2,1-5H3/b12-9-/t14-,15-,17-,18-/m0/s1 |
| InChIKey | QTHXBFPYYCTVGR-QCBXLARMSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|