About 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine
8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine (PubChem CID 138606758) has the molecular formula C20H19N4+
and a molecular weight of 315.40 g/mol. Its IUPAC name is 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine.
Molecular Properties
| Compound Name | 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine |
| PubChem CID | 138606758 |
| Molecular Formula | C20H19N4+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine |
| SMILES | CNc1ccc2nc3cc(C)c(N)cc3[n+](-c3ccccc3)c2c1 |
| InChI | InChI=1S/C20H18N4/c1-13-10-18-20(12-16(13)21)24(15-6-4-3-5-7-15)19-11-14(22-2)8-9-17(19)23-18/h3-12H,1-2H3,(H2,21,22)/p+1 |
| InChIKey | XKFOAPOGDFIMLS-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine?
The IUPAC name of 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine (CID 138606758) is 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine.
What is the SMILES notation for 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine?
The canonical SMILES for 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine is CNc1ccc2nc3cc(C)c(N)cc3[n+](-c3ccccc3)c2c1.
What is the InChIKey of 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine?
The InChIKey is XKFOAPOGDFIMLS-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H18N4/c1-13-10-18-20(12-16(13)21)24(15-6-4-3-5-7-15)19-11-14(22-2)8-9-17(19)23-18/h3-12H,1-2H3,(H2,21,22)/p+1.
What are the key properties of 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine?
8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine has a molecular weight of 315.40 g/mol, XLogP of 3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N,3-dimethyl-10-phenylphenazin-10-ium-2,8-diamine is sourced from PubChem (CID 138606758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).