About 3-methyl-10-phenylphenazin-10-ium-2,8-diamine
3-methyl-10-phenylphenazin-10-ium-2,8-diamine (PubChem CID 138606760) has the molecular formula C19H17N4+
and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-methyl-10-phenylphenazin-10-ium-2,8-diamine.
Molecular Properties
| Compound Name | 3-methyl-10-phenylphenazin-10-ium-2,8-diamine |
| PubChem CID | 138606760 |
| Molecular Formula | C19H17N4+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-methyl-10-phenylphenazin-10-ium-2,8-diamine |
| SMILES | Cc1cc2nc3ccc(N)cc3[n+](-c3ccccc3)c2cc1N |
| InChI | InChI=1S/C19H16N4/c1-12-9-17-19(11-15(12)21)23(14-5-3-2-4-6-14)18-10-13(20)7-8-16(18)22-17/h2-11H,1H3,(H3,20,21)/p+1 |
| InChIKey | SUVKCOJBXZYXIG-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-10-phenylphenazin-10-ium-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-10-phenylphenazin-10-ium-2,8-diamine?
The IUPAC name of 3-methyl-10-phenylphenazin-10-ium-2,8-diamine (CID 138606760) is 3-methyl-10-phenylphenazin-10-ium-2,8-diamine.
What is the SMILES notation for 3-methyl-10-phenylphenazin-10-ium-2,8-diamine?
The canonical SMILES for 3-methyl-10-phenylphenazin-10-ium-2,8-diamine is Cc1cc2nc3ccc(N)cc3[n+](-c3ccccc3)c2cc1N.
What is the InChIKey of 3-methyl-10-phenylphenazin-10-ium-2,8-diamine?
The InChIKey is SUVKCOJBXZYXIG-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H16N4/c1-12-9-17-19(11-15(12)21)23(14-5-3-2-4-6-14)18-10-13(20)7-8-16(18)22-17/h2-11H,1H3,(H3,20,21)/p+1.
What are the key properties of 3-methyl-10-phenylphenazin-10-ium-2,8-diamine?
3-methyl-10-phenylphenazin-10-ium-2,8-diamine has a molecular weight of 301.37 g/mol, XLogP of 3.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-10-phenylphenazin-10-ium-2,8-diamine is sourced from PubChem (CID 138606760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).