C18H25NO2 — CID 138606828
(2R,4aS,4bR,8aS,10aS)-9-amino-2,4,4-trimethyl-5-methylidene-1,2,4a,4b,7,8,8a,10a-octahydrophenanthrene-3,6-dione (PubChem CID 138606828) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2R,4aS,4bR,8aS,10aS)-9-amino-2,4,4-trimethyl-5-methylidene-1,2,4a,4b,7,8,8a,10a-octahydrophenanthrene-3,6-dione.
| Compound Name | (2R,4aS,4bR,8aS,10aS)-9-amino-2,4,4-trimethyl-5-methylidene-1,2,4a,4b,7,8,8a,10a-octahydrophenanthrene-3,6-dione |
|---|---|
| PubChem CID | 138606828 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (2R,4aS,4bR,8aS,10aS)-9-amino-2,4,4-trimethyl-5-methylidene-1,2,4a,4b,7,8,8a,10a-octahydrophenanthrene-3,6-dione |
| SMILES | C=C1C(=O)CC[C@@H]2C(N)=C[C@H]3C[C@@H](C)C(=O)C(C)(C)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C18H25NO2/c1-9-7-11-8-13(19)12-5-6-14(20)10(2)15(12)16(11)18(3,4)17(9)21/h8-9,11-12,15-16H,2,5-7,19H2,1,3-4H3/t9-,11-,12-,15+,16+/m1/s1 |
| InChIKey | WHNFISYXPUYHDW-DXUMZHCMSA-N |
| XLogP | 2.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|