C29H32N2O2 — CID 138606895
(2R,3S)-3-hydroxy-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxamide (PubChem CID 138606895) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | (2R,3S)-3-hydroxy-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 138606895 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (2R,3S)-3-hydroxy-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidine-2-carboxamide |
| SMILES | Cc1cc(CN2CCC[C@H](O)[C@@H]2C(N)=O)ccc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C29H32N2O2/c1-20-18-22(19-31-17-7-12-27(32)28(31)29(30)33)13-14-23(20)15-16-24-10-6-11-26(21(24)2)25-8-4-3-5-9-25/h3-6,8-11,13-16,18,27-28,32H,7,12,17,19H2,1-2H3,(H2,30,33)/b16-15+/t27-,28+/m0/s1 |
| InChIKey | HHYNAVSDVWCVSM-DVLGSLEDSA-N |
| XLogP | 4.95 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|