C11H16F3N — CID 138607005
(1E,3Z,5Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3,5-trien-1-amine (PubChem CID 138607005) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (1E,3Z,5Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 138607005 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (1E,3Z,5Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C=C(C(=C\N)/C(F)(F)F)\C(C)C |
| InChI | InChI=1S/C11H16F3N/c1-4-5-6-9(8(2)3)10(7-15)11(12,13)14/h4-8H,15H2,1-3H3/b5-4-,9-6-,10-7+ |
| InChIKey | XOPHRVPWJDGPBE-NZPKQRPTSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|