C24H21FN6O3S2 — CID 138607173
4-fluoro-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 138607173) has the molecular formula C24H21FN6O3S2 and a molecular weight of 524.60 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138607173 |
| Molecular Formula | C24H21FN6O3S2 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 4-fluoro-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNS(=O)(=O)c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C24H21FN6O3S2/c1-34-18-4-2-3-16(15-18)21-22(31-13-14-35-24(31)30-21)20-9-10-26-23(29-20)27-11-12-28-36(32,33)19-7-5-17(25)6-8-19/h2-10,13-15,28H,11-12H2,1H3,(H,26,27,29) |
| InChIKey | RJBGBFUWDAKFSW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|