C25H24N6O4S2 — CID 138607212
4-methoxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 138607212) has the molecular formula C25H24N6O4S2 and a molecular weight of 536.64 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138607212 |
| Molecular Formula | C25H24N6O4S2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 4-methoxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2nccc(-c3c(-c4cccc(OC)c4)nc4sccn34)n2)cc1 |
| InChI | InChI=1S/C25H24N6O4S2/c1-34-18-6-8-20(9-7-18)37(32,33)28-13-12-27-24-26-11-10-21(29-24)23-22(30-25-31(23)14-15-36-25)17-4-3-5-19(16-17)35-2/h3-11,14-16,28H,12-13H2,1-2H3,(H,26,27,29) |
| InChIKey | NLVDXVNGRDBBHC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|