C23H20N6O3S2 — CID 138607223
4-hydroxy-N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 138607223) has the molecular formula C23H20N6O3S2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-hydroxy-N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138607223 |
| Molecular Formula | C23H20N6O3S2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-hydroxy-N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1nccc(-c2c(-c3ccccc3)nc3sccn23)n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H20N6O3S2/c30-17-6-8-18(9-7-17)34(31,32)26-13-12-25-22-24-11-10-19(27-22)21-20(16-4-2-1-3-5-16)28-23-29(21)14-15-33-23/h1-11,14-15,26,30H,12-13H2,(H,24,25,27) |
| InChIKey | FEWMZSLBPULECY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|