C24H22N6O3S2 — CID 138607224
N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 138607224) has the molecular formula C24H22N6O3S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138607224 |
| Molecular Formula | C24H22N6O3S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNS(=O)(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H22N6O3S2/c1-33-18-7-5-6-17(16-18)21-22(30-14-15-34-24(30)29-21)20-10-11-25-23(28-20)26-12-13-27-35(31,32)19-8-3-2-4-9-19/h2-11,14-16,27H,12-13H2,1H3,(H,25,26,28) |
| InChIKey | GHEKKLAAPQPHPZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|