C24H36N4O5 — CID 138607301
N-(5-tert-butyl-1,2-oxazol-3-yl)-5-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 138607301) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-5-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-5-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 138607301 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-5-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C2CC3(CC3)CN2C(=O)C(CC2CCCC2)CN(O)C=O)no1 |
| InChI | InChI=1S/C24H36N4O5/c1-23(2,3)19-11-20(26-33-19)25-21(30)18-12-24(8-9-24)14-28(18)22(31)17(13-27(32)15-29)10-16-6-4-5-7-16/h11,15-18,32H,4-10,12-14H2,1-3H3,(H,25,26,30) |
| InChIKey | FDULHEIJGWNSLU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|