C14H12F6N2O2 — CID 138607506
3-(trifluoromethoxy)-4-[2-(trifluoromethoxy)phenyl]cyclohexa-2,5-diene-1,1-diamine (PubChem CID 138607506) has the molecular formula C14H12F6N2O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-4-[2-(trifluoromethoxy)phenyl]cyclohexa-2,5-diene-1,1-diamine.
| Compound Name | 3-(trifluoromethoxy)-4-[2-(trifluoromethoxy)phenyl]cyclohexa-2,5-diene-1,1-diamine |
|---|---|
| PubChem CID | 138607506 |
| Molecular Formula | C14H12F6N2O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-(trifluoromethoxy)-4-[2-(trifluoromethoxy)phenyl]cyclohexa-2,5-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(c2ccccc2OC(F)(F)F)C(OC(F)(F)F)=C1 |
| InChI | InChI=1S/C14H12F6N2O2/c15-13(16,17)23-10-4-2-1-3-8(10)9-5-6-12(21,22)7-11(9)24-14(18,19)20/h1-7,9H,21-22H2 |
| InChIKey | GGVFVFQSNSOPTI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|