C15H28FN3OS — CID 138607830
N-[1-(1-ethylsulfanylethyl)piperidin-4-yl]-4-fluoropiperidine-1-carboxamide (PubChem CID 138607830) has the molecular formula C15H28FN3OS and a molecular weight of 317.47 g/mol. Its IUPAC name is N-[1-(1-ethylsulfanylethyl)piperidin-4-yl]-4-fluoropiperidine-1-carboxamide.
| Compound Name | N-[1-(1-ethylsulfanylethyl)piperidin-4-yl]-4-fluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 138607830 |
| Molecular Formula | C15H28FN3OS |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[1-(1-ethylsulfanylethyl)piperidin-4-yl]-4-fluoropiperidine-1-carboxamide |
| SMILES | CCSC(C)N1CCC(NC(=O)N2CCC(F)CC2)CC1 |
| InChI | InChI=1S/C15H28FN3OS/c1-3-21-12(2)18-10-6-14(7-11-18)17-15(20)19-8-4-13(16)5-9-19/h12-14H,3-11H2,1-2H3,(H,17,20) |
| InChIKey | ZLOPFBPKBZBBRX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |