C20H26N6O3 — CID 138608019
3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenyl]propyl carbamate (PubChem CID 138608019) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenyl]propyl carbamate.
| Compound Name | 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenyl]propyl carbamate |
|---|---|
| PubChem CID | 138608019 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenyl]propyl carbamate |
| SMILES | CCNc1ncc2c(n1)N(C)CCN(c1cccc(CCCOC(N)=O)c1)C2=O |
| InChI | InChI=1S/C20H26N6O3/c1-3-22-20-23-13-16-17(24-20)25(2)9-10-26(18(16)27)15-8-4-6-14(12-15)7-5-11-29-19(21)28/h4,6,8,12-13H,3,5,7,9-11H2,1-2H3,(H2,21,28)(H,22,23,24) |
| InChIKey | VRDCQSMNAXADOG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|