About 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid
4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 1386085) has the molecular formula C18H17N5O3S
and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
| PubChem CID | 1386085 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | Cc1cccc(C)c1NC(=O)CSc1nnnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-11-4-3-5-12(2)16(11)19-15(24)10-27-18-20-21-22-23(18)14-8-6-13(7-9-14)17(25)26/h3-9H,10H2,1-2H3,(H,19,24)(H,25,26) |
| InChIKey | CVVNLECKZRYEIZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid?
The IUPAC name of 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid (CID 1386085) is 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid.
What is the SMILES notation for 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid?
The canonical SMILES for 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid is Cc1cccc(C)c1NC(=O)CSc1nnnn1-c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid?
The InChIKey is CVVNLECKZRYEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O3S/c1-11-4-3-5-12(2)16(11)19-15(24)10-27-18-20-21-22-23(18)14-8-6-13(7-9-14)17(25)26/h3-9H,10H2,1-2H3,(H,19,24)(H,25,26).
What are the key properties of 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid?
4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid has a molecular weight of 383.43 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid is sourced from PubChem (CID 1386085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).