C16H22F3N3O6 — CID 138608560
4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]morpholin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 138608560) has the molecular formula C16H22F3N3O6 and a molecular weight of 409.36 g/mol. Its IUPAC name is 4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]morpholin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]morpholin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138608560 |
| Molecular Formula | C16H22F3N3O6 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]morpholin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CNc1ccc(CN2CCOCC2=O)c(C(OC)OC)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O4.C2HF3O2/c1-15-11-5-4-10(13(16-11)14(19-2)20-3)8-17-6-7-21-9-12(17)18;3-2(4,5)1(6)7/h4-5,14H,6-9H2,1-3H3,(H,15,16);(H,6,7) |
| InChIKey | OIOSEWLNYGAURJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|