C16H24F3N3O4 — CID 138608588
6-(dimethoxymethyl)-N-methyl-5-piperidin-4-ylpyridin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 138608588) has the molecular formula C16H24F3N3O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-(dimethoxymethyl)-N-methyl-5-piperidin-4-ylpyridin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(dimethoxymethyl)-N-methyl-5-piperidin-4-ylpyridin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138608588 |
| Molecular Formula | C16H24F3N3O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 6-(dimethoxymethyl)-N-methyl-5-piperidin-4-ylpyridin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | CNc1ccc(C2CCNCC2)c(C(OC)OC)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N3O2.C2HF3O2/c1-15-12-5-4-11(10-6-8-16-9-7-10)13(17-12)14(18-2)19-3;3-2(4,5)1(6)7/h4-5,10,14,16H,6-9H2,1-3H3,(H,15,17);(H,6,7) |
| InChIKey | JYUHCEDQOKDHNJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|