About [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid
[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid (PubChem CID 138609533) has the molecular formula C6H15NO6S
and a molecular weight of 229.25 g/mol. Its IUPAC name is [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid.
Molecular Properties
| Compound Name | [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid |
| PubChem CID | 138609533 |
| Molecular Formula | C6H15NO6S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid |
| SMILES | CCN(C(CO)(CO)CO)S(=O)(=O)O |
| InChI | InChI=1S/C6H15NO6S/c1-2-7(14(11,12)13)6(3-8,4-9)5-10/h8-10H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | VOPUFNKBDURIBY-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid?
The IUPAC name of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid (CID 138609533) is [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid.
What is the SMILES notation for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid?
The canonical SMILES for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid is CCN(C(CO)(CO)CO)S(=O)(=O)O.
What is the InChIKey of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid?
The InChIKey is VOPUFNKBDURIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO6S/c1-2-7(14(11,12)13)6(3-8,4-9)5-10/h8-10H,2-5H2,1H3,(H,11,12,13).
What are the key properties of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid?
[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid has a molecular weight of 229.25 g/mol, XLogP of -2.17, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-ethylsulfamic acid is sourced from PubChem (CID 138609533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).