C34H33F4N5O6 — CID 138609546
(Z)-but-2-enedioic acid;(E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide (PubChem CID 138609546) has the molecular formula C34H33F4N5O6 and a molecular weight of 683.66 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 138609546 |
| Molecular Formula | C34H33F4N5O6 |
| Molecular Weight | 683.66 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C30H29F4N5O2.C4H4O4/c1-39(2)27(40)9-6-14-35-15-16-41-26-13-11-22(19-36-26)28(21-10-12-25-23(17-21)29(31)38-37-25)24(18-30(32,33)34)20-7-4-3-5-8-20;5-3(6)1-2-4(7)8/h3-13,17,19,35H,14-16,18H2,1-2H3,(H,37,38);1-2H,(H,5,6)(H,7,8)/b9-6+,28-24-;2-1- |
| InChIKey | PVZSEFWTXTYFBO-TVCZABNHSA-N |
| XLogP | 5.33 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|