C27H25ClF4N4O3S — CID 138609768
3-[[7-[5-chloro-3-methyl-2-[(3S,4R)-3-methylpiperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138609768) has the molecular formula C27H25ClF4N4O3S and a molecular weight of 597.03 g/mol. Its IUPAC name is 3-[[7-[5-chloro-3-methyl-2-[(3S,4R)-3-methylpiperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[5-chloro-3-methyl-2-[(3S,4R)-3-methylpiperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138609768 |
| Molecular Formula | C27H25ClF4N4O3S |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 3-[[7-[5-chloro-3-methyl-2-[(3S,4R)-3-methylpiperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-5-fluoro-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(Cn4c(=O)c(F)cn(CC(F)(F)F)c4=O)sc23)c1O[C@@H]1CCNC[C@@H]1C |
| InChI | InChI=1S/C27H25ClF4N4O3S/c1-14-7-16(28)8-19(23(14)39-22-4-5-33-10-15(22)2)18-3-6-34-21-9-17(40-24(18)21)11-36-25(37)20(29)12-35(26(36)38)13-27(30,31)32/h3,6-9,12,15,22,33H,4-5,10-11,13H2,1-2H3/t15-,22+/m0/s1 |
| InChIKey | MPJMYGGCKJDYSS-OYHNWAKOSA-N |
| XLogP | 5.38 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |