C28H28ClF3N4O3S — CID 138609818
3-[[7-[5-chloro-2-[(3S)-6,6-dimethylpiperidin-3-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138609818) has the molecular formula C28H28ClF3N4O3S and a molecular weight of 593.07 g/mol. Its IUPAC name is 3-[[7-[5-chloro-2-[(3S)-6,6-dimethylpiperidin-3-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[5-chloro-2-[(3S)-6,6-dimethylpiperidin-3-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138609818 |
| Molecular Formula | C28H28ClF3N4O3S |
| Molecular Weight | 593.07 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 3-[[7-[5-chloro-2-[(3S)-6,6-dimethylpiperidin-3-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)sc23)c1O[C@H]1CCC(C)(C)NC1 |
| InChI | InChI=1S/C28H28ClF3N4O3S/c1-16-10-17(29)11-21(24(16)39-18-4-7-27(2,3)34-13-18)20-5-8-33-22-12-19(40-25(20)22)14-36-23(37)6-9-35(26(36)38)15-28(30,31)32/h5-6,8-12,18,34H,4,7,13-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | ICLMCYJRHLGTDX-SFHVURJKSA-N |
| XLogP | 5.77 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.07 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |