C31H32ClF3N4O4S — CID 138609912
3-[[7-[5-chloro-3-methyl-2-[(3R,4R)-3-methyl-1-(oxolan-3-yl)piperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138609912) has the molecular formula C31H32ClF3N4O4S and a molecular weight of 649.14 g/mol. Its IUPAC name is 3-[[7-[5-chloro-3-methyl-2-[(3R,4R)-3-methyl-1-(oxolan-3-yl)piperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[5-chloro-3-methyl-2-[(3R,4R)-3-methyl-1-(oxolan-3-yl)piperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138609912 |
| Molecular Formula | C31H32ClF3N4O4S |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | 3-[[7-[5-chloro-3-methyl-2-[(3R,4R)-3-methyl-1-(oxolan-3-yl)piperidin-4-yl]oxyphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)sc23)c1O[C@@H]1CCN(C2CCOC2)C[C@H]1C |
| InChI | InChI=1S/C31H32ClF3N4O4S/c1-18-11-20(32)12-24(28(18)43-26-4-8-37(14-19(26)2)21-6-10-42-16-21)23-3-7-36-25-13-22(44-29(23)25)15-39-27(40)5-9-38(30(39)41)17-31(33,34)35/h3,5,7,9,11-13,19,21,26H,4,6,8,10,14-17H2,1-2H3/t19-,21?,26-/m1/s1 |
| InChIKey | GPTXHOHMNRMYSQ-TUKXDAAISA-N |
| XLogP | 5.74 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |