C25H19F3N6O5S — CID 138609976
3-[[7-[3-methyl-2-(2-methylpyrazol-3-yl)oxy-5-nitrophenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138609976) has the molecular formula C25H19F3N6O5S and a molecular weight of 572.53 g/mol. Its IUPAC name is 3-[[7-[3-methyl-2-(2-methylpyrazol-3-yl)oxy-5-nitrophenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[3-methyl-2-(2-methylpyrazol-3-yl)oxy-5-nitrophenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138609976 |
| Molecular Formula | C25H19F3N6O5S |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 3-[[7-[3-methyl-2-(2-methylpyrazol-3-yl)oxy-5-nitrophenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc([N+](=O)[O-])cc(-c2ccnc3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)sc23)c1Oc1ccnn1C |
| InChI | InChI=1S/C25H19F3N6O5S/c1-14-9-15(34(37)38)10-18(22(14)39-21-4-7-30-31(21)2)17-3-6-29-19-11-16(40-23(17)19)12-33-20(35)5-8-32(24(33)36)13-25(26,27)28/h3-11H,12-13H2,1-2H3 |
| InChIKey | BWYFFQQNMOXYJB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 127.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|