C30H32ClF3N4O4S — CID 138610093
3-[[7-[5-chloro-2-[(3R,4R)-1-(2-methoxyethyl)-3-methylpiperidin-4-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138610093) has the molecular formula C30H32ClF3N4O4S and a molecular weight of 637.12 g/mol. Its IUPAC name is 3-[[7-[5-chloro-2-[(3R,4R)-1-(2-methoxyethyl)-3-methylpiperidin-4-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[5-chloro-2-[(3R,4R)-1-(2-methoxyethyl)-3-methylpiperidin-4-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138610093 |
| Molecular Formula | C30H32ClF3N4O4S |
| Molecular Weight | 637.12 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 3-[[7-[5-chloro-2-[(3R,4R)-1-(2-methoxyethyl)-3-methylpiperidin-4-yl]oxy-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | COCCN1CC[C@@H](Oc2c(C)cc(Cl)cc2-c2ccnc3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)sc23)[C@H](C)C1 |
| InChI | InChI=1S/C30H32ClF3N4O4S/c1-18-12-20(31)13-23(27(18)42-25-5-8-36(10-11-41-3)15-19(25)2)22-4-7-35-24-14-21(43-28(22)24)16-38-26(39)6-9-37(29(38)40)17-30(32,33)34/h4,6-7,9,12-14,19,25H,5,8,10-11,15-17H2,1-3H3/t19-,25-/m1/s1 |
| InChIKey | LFJBBSSUJOJSBS-KBMIEXCESA-N |
| XLogP | 5.59 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |