C27H24ClF3N4O3S — CID 138610353
3-[[7-[2-[[(3S,4R)-1-azabicyclo[2.2.1]heptan-3-yl]oxy]-5-chloro-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 138610353) has the molecular formula C27H24ClF3N4O3S and a molecular weight of 577.03 g/mol. Its IUPAC name is 3-[[7-[2-[[(3S,4R)-1-azabicyclo[2.2.1]heptan-3-yl]oxy]-5-chloro-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[[7-[2-[[(3S,4R)-1-azabicyclo[2.2.1]heptan-3-yl]oxy]-5-chloro-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138610353 |
| Molecular Formula | C27H24ClF3N4O3S |
| Molecular Weight | 577.03 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 3-[[7-[2-[[(3S,4R)-1-azabicyclo[2.2.1]heptan-3-yl]oxy]-5-chloro-3-methylphenyl]thieno[3,2-b]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(Cn4c(=O)ccn(CC(F)(F)F)c4=O)sc23)c1O[C@@H]1CN2CC[C@@H]1C2 |
| InChI | InChI=1S/C27H24ClF3N4O3S/c1-15-8-17(28)9-20(24(15)38-22-13-33-6-3-16(22)11-33)19-2-5-32-21-10-18(39-25(19)21)12-35-23(36)4-7-34(26(35)37)14-27(29,30)31/h2,4-5,7-10,16,22H,3,6,11-14H2,1H3/t16-,22-/m1/s1 |
| InChIKey | QSIZBGNLWAPCDQ-OPAMFIHVSA-N |
| XLogP | 4.94 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |