C25H23ClFN3O3 — CID 138610526
1-[[4-[5-chloro-2-[(3R,4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 138610526) has the molecular formula C25H23ClFN3O3 and a molecular weight of 467.93 g/mol. Its IUPAC name is 1-[[4-[5-chloro-2-[(3R,4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[5-chloro-2-[(3R,4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 138610526 |
| Molecular Formula | C25H23ClFN3O3 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-[[4-[5-chloro-2-[(3R,4S)-4-fluoropyrrolidin-3-yl]oxy-3-methylphenyl]quinolin-7-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(CN4C(=O)CCC4=O)ccc23)c1O[C@@H]1CNC[C@@H]1F |
| InChI | InChI=1S/C25H23ClFN3O3/c1-14-8-16(26)10-19(25(14)33-22-12-28-11-20(22)27)17-6-7-29-21-9-15(2-3-18(17)21)13-30-23(31)4-5-24(30)32/h2-3,6-10,20,22,28H,4-5,11-13H2,1H3/t20-,22+/m0/s1 |
| InChIKey | YFFRVAOLQRCXKN-RBBKRZOGSA-N |
| XLogP | 4.20 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|