C47H45Cl2FN8O7 — CID 138610555
CID 138610555 (PubChem CID 138610555) has the molecular formula C47H45Cl2FN8O7 and a molecular weight of 923.83 g/mol.
| Compound Name | CID 138610555 |
|---|---|
| PubChem CID | 138610555 |
| Molecular Formula | C47H45Cl2FN8O7 |
| Molecular Weight | 923.83 g/mol |
| Exact Mass | 922.28 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCCCNC(=O)c4ccc(NC(=O)[C@@H]5NC6(CCCCC6)[C@@]6(C(=O)Nc7cc(Cl)ccc76)[C@H]5c5cccc(Cl)c5F)cn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H45Cl2FN8O7/c48-25-13-15-30-34(22-25)55-45(65)47(30)38(28-9-6-10-31(49)39(28)50)40(57-46(47)19-3-1-4-20-46)43(63)53-26-14-16-33(52-23-26)41(61)51-21-5-2-12-36(59)54-32-11-7-8-27-29(32)24-58(44(27)64)35-17-18-37(60)56-42(35)62/h6-11,13-16,22-23,35,38,40,57H,1-5,12,17-21,24H2,(H,51,61)(H,53,63)(H,54,59)(H,55,65)(H,56,60,62)/t35?,38-,40+,47+/m0/s1 |
| InChIKey | ZTBLUWYNSDVDKY-RKUZKHJWSA-N |
| XLogP | 6.11 |
| TPSA | 207.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.83 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|