C22H31N7O4 — CID 138610986
(2S)-2-(cyanomethyl)-4-[2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]piperazine-1-carboxylic acid (PubChem CID 138610986) has the molecular formula C22H31N7O4 and a molecular weight of 457.54 g/mol. Its IUPAC name is (2S)-2-(cyanomethyl)-4-[2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]piperazine-1-carboxylic acid.
| Compound Name | (2S)-2-(cyanomethyl)-4-[2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 138610986 |
| Molecular Formula | C22H31N7O4 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (2S)-2-(cyanomethyl)-4-[2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl]piperazine-1-carboxylic acid |
| SMILES | N#CC[C@H]1CN(c2nc(OCCCN3C[C@@H]4C[C@H]3CO4)nc3c2CCNC3)CCN1C(=O)O |
| InChI | InChI=1S/C22H31N7O4/c23-4-2-15-12-28(7-8-29(15)22(30)31)20-18-3-5-24-11-19(18)25-21(26-20)32-9-1-6-27-13-17-10-16(27)14-33-17/h15-17,24H,1-3,5-14H2,(H,30,31)/t15-,16-,17-/m0/s1 |
| InChIKey | KSULQSXAMKWDNR-ULQDDVLXSA-N |
| XLogP | 0.45 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|