C43H45F2N5O7S — CID 138611562
N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-3-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexoxy]propanamide (PubChem CID 138611562) has the molecular formula C43H45F2N5O7S and a molecular weight of 813.92 g/mol. Its IUPAC name is N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-3-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexoxy]propanamide.
| Compound Name | N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-3-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexoxy]propanamide |
|---|---|
| PubChem CID | 138611562 |
| Molecular Formula | C43H45F2N5O7S |
| Molecular Weight | 813.92 g/mol |
| Exact Mass | 813.30 |
| IUPAC Name | N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-3-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexoxy]propanamide |
| SMILES | NC(=S)c1cccc(-c2cn(C3CCC(F)(F)CC3)c3cc(NC(=O)CCOCCCCCCOc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)ccc23)c1 |
| InChI | InChI=1S/C43H45F2N5O7S/c44-43(45)18-15-29(16-19-43)49-25-32(26-7-5-8-27(23-26)39(46)58)30-12-11-28(24-34(30)49)47-37(52)17-22-56-20-3-1-2-4-21-57-35-10-6-9-31-38(35)42(55)50(41(31)54)33-13-14-36(51)48-40(33)53/h5-12,23-25,29,33H,1-4,13-22H2,(H2,46,58)(H,47,52)(H,48,51,53) |
| InChIKey | VKLDTFVRSQHSAT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.92 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|