C47H44Cl2FN7O6 — CID 138611891
CID 138611891 (PubChem CID 138611891) has the molecular formula C47H44Cl2FN7O6 and a molecular weight of 892.82 g/mol.
| Compound Name | CID 138611891 |
|---|---|
| PubChem CID | 138611891 |
| Molecular Formula | C47H44Cl2FN7O6 |
| Molecular Weight | 892.82 g/mol |
| Exact Mass | 891.27 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(/C=C/CCCNC(=O)c4ccc(NC(=O)[C@@H]5NC6(CCCCC6)[C@@]6(C(=O)Nc7cc(Cl)ccc76)[C@H]5c5cccc(Cl)c5F)cn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H44Cl2FN7O6/c48-27-14-16-32-35(23-27)54-45(63)47(32)38(30-12-8-13-33(49)39(30)50)40(56-46(47)20-4-2-5-21-46)43(61)53-28-15-17-34(52-24-28)41(59)51-22-6-1-3-9-26-10-7-11-29-31(26)25-57(44(29)62)36-18-19-37(58)55-42(36)60/h3,7-17,23-24,36,38,40,56H,1-2,4-6,18-22,25H2,(H,51,59)(H,53,61)(H,54,63)(H,55,58,60)/b9-3+/t36?,38-,40+,47+/m0/s1 |
| InChIKey | RHQVARVIARIOMY-TXMNJXGPSA-N |
| XLogP | 6.80 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.82 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|