About 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran
2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran (PubChem CID 138612128) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran |
| PubChem CID | 138612128 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran |
| SMILES | C=C/C=C\c1oc2ccc(C)cc2c1C |
| InChI | InChI=1S/C14H14O/c1-4-5-6-13-11(3)12-9-10(2)7-8-14(12)15-13/h4-9H,1H2,2-3H3/b6-5- |
| InChIKey | GMLLZHYYIIZKRN-WAYWQWQTSA-N |
| XLogP | 4.25 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran (CID 138612128) is 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran is C=C/C=C\c1oc2ccc(C)cc2c1C.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran?
The InChIKey is GMLLZHYYIIZKRN-WAYWQWQTSA-N. The full InChI is InChI=1S/C14H14O/c1-4-5-6-13-11(3)12-9-10(2)7-8-14(12)15-13/h4-9H,1H2,2-3H3/b6-5-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran?
2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran has a molecular weight of 198.26 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1-benzofuran is sourced from PubChem (CID 138612128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).